Attributes
UniProt ID
Protein Name
Uridine phosphorylase
Ligand Name
2,2'-Anhydro-(1-beta-D-arabinofuranosyl)uracil
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UUGITDASWNOAGG-CCXZUQQUSA-N
SMILES
C1=CN2C3C(C(C(O3)CO)O)OC2=NC1=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2OEC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2oecA1e2oecB1e2oecC1e2oecD1e2oecE1e2oecF1
ECOD domains from experimental PDB structures interacting with ligand DB04627
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A1F6 | DB04627 | ANU | 2oec | e2oecA1 | A:1002-1253 |
| P0A1F6 | DB04627 | ANU | 2oec | e2oecB1 | B:1003-1253 |
| P0A1F6 | DB04627 | ANU | 2oec | e2oecE1 | E:1004-1253 |
| P0A1F6 | DB04627 | ANU | 2oec | e2oecF1 | F:1004-1253 |
| P0A1F6 | DB04627 | ANU | 2pga | e2pgaA1 | A:1004-1253 |
| P0A1F6 | DB04627 | ANU | 2pga | e2pgaB1 | B:6004-6253 |
| P0A1F6 | DB04627 | ANU | 2pga | e2pgaD1 | D:3004-3253 |
| P0A1F6 | DB04627 | ANU | 2pga | e2pgaF1 | F:4003-4253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74A1 | A:1004-1253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74B1 | B:2003-2253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74C1 | C:3004-3253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74D1 | D:4003-4253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74E1 | E:5004-5253 |
| P0A1F6 | DB04627 | ANU | 3c74 | e3c74F1 | F:6004-6253 |
| P0A1F6 | DB04627 | ANU | 3fwp | e3fwpA1 | A:1003-1253 |
| P0A1F6 | DB04627 | ANU | 3fwp | e3fwpB1 | B:6004-6253 |
| P0A1F6 | DB04627 | ANU | 3fwp | e3fwpD1 | D:3004-3253 |
| P0A1F6 | DB04627 | ANU | 3fwp | e3fwpF1 | F:4003-4253 |