Attributes
UniProt ID
Protein Name
Tryptophan synthase beta chain
Ligand Name
(E)-N-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene)-L-serine
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZTQZHYMXYBDMIL-BIMOUXMDSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(CO)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6DZ4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6dz4A1e6dz4B1e6dz4B2
ECOD domains from experimental PDB structures interacting with ligand KOU
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A2K1 | n/a | KOU | 6dz4 | e6dz4B1 | B:2-200 |
| P0A2K1 | n/a | KOU | 6dz4 | e6dz4B2 | B:201-396 |
| P0A2K1 | n/a | KOU | 6dzo | e6dzoB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 6dzo | e6dzoB2 | B:201-395 |
| P0A2K1 | n/a | KOU | 6wdu | e6wduB1 | B:201-397 |
| P0A2K1 | n/a | KOU | 6wdu | e6wduB2 | B:2-200 |
| P0A2K1 | n/a | KOU | 6xsy | e6xsyB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 6xsy | e6xsyB2 | B:201-397 |
| P0A2K1 | n/a | KOU | 7jmq | e7jmqB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7jmq | e7jmqB2 | B:201-397 |
| P0A2K1 | n/a | KOU | 7jqw | e7jqwB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7jqw | e7jqwB2 | B:201-396 |
| P0A2K1 | n/a | KOU | 7jtt | e7jttB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7jtt | e7jttB2 | B:201-397 |
| P0A2K1 | n/a | KOU | 7k5a | e7k5aB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7k5a | e7k5aB2 | B:201-396 |
| P0A2K1 | n/a | KOU | 7ki7 | e7ki7B1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7ki7 | e7ki7B2 | B:201-396 |
| P0A2K1 | n/a | KOU | 7l5h | e7l5hB1 | B:2-200 |
| P0A2K1 | n/a | KOU | 7l5h | e7l5hB2 | B:201-396 |