Attributes
UniProt ID
Protein Name
Tryptophan synthase beta chain
Ligand Name
[3-HYDROXY-2-METHYL-5-PHOSPHONOOXYMETHYL-PYRIDIN-4-YLMETHYL]-SERINE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ODVKKQWXKRZJLG-VIFPVBQESA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CNC(CO)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1BEU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1beuA1e1beuB1e1beuB2
ECOD domains from experimental PDB structures interacting with ligand PLS
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A2K1 | n/a | PLS | 1beu | e1beuB1 | B:201-391 |
| P0A2K1 | n/a | PLS | 1beu | e1beuB2 | B:3-200 |
| P0A2K1 | n/a | PLS | 1kfe | e1kfeB1 | B:201-395 |
| P0A2K1 | n/a | PLS | 1kfe | e1kfeB2 | B:2-200 |
| P0A2K1 | n/a | PLS | 1kfj | e1kfjB1 | B:2-200 |
| P0A2K1 | n/a | PLS | 1kfj | e1kfjB2 | B:201-395 |
| P0A2K1 | n/a | PLS | 2cll | e2cllB1 | B:201-395 |
| P0A2K1 | n/a | PLS | 2cll | e2cllB2 | B:2-200 |
| P0A2K1 | n/a | PLS | 2clm | e2clmB1 | B:2-200 |
| P0A2K1 | n/a | PLS | 2clm | e2clmB2 | B:201-394 |
| P0A2K1 | n/a | PLS | 2clo | e2cloB1 | B:201-392 |
| P0A2K1 | n/a | PLS | 2clo | e2cloB2 | B:2-200 |
| P0A2K1 | n/a | PLS | 2trs | e2trsB1 | B:3-200 |
| P0A2K1 | n/a | PLS | 2trs | e2trsB2 | B:201-391 |
| P0A2K1 | n/a | PLS | 2tsy | e2tsyB1 | B:201-391 |
| P0A2K1 | n/a | PLS | 2tsy | e2tsyB2 | B:3-200 |
| P0A2K1 | n/a | PLS | 8b05 | e8b05B1 | B:201-395 |
| P0A2K1 | n/a | PLS | 8b05 | e8b05B2 | B:2-200 |
| P0A2K1 | n/a | PLS | 8b08 | e8b08B1 | B:201-395 |
| P0A2K1 | n/a | PLS | 8b08 | e8b08B2 | B:2-200 |