Attributes
UniProt ID
Protein Name
Nitrogen regulatory protein P-II
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2XBP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2xbpA1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A3F4 | DB00171 | ATP | 2xbp | e2xbpA1 | A:1-113 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulA1 | A:1-113 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulB1 | B:1-115 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulC1 | C:1-113 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulD1 | D:1-114 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulE1 | E:1-112 |
| P0A3F4 | DB00171 | ATP | 2xul | e2xulF1 | F:1-113 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwA1 | A:1-115 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwB1 | B:1-115 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwC1 | C:1-113 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwD1 | D:1-115 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwE1 | E:1-111 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwF1 | F:1-113 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwG1 | G:1-115 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwH1 | H:1-109 |
| P0A3F4 | DB00171 | ATP | 2xzw | e2xzwI1 | I:1-109 |