Attributes
UniProt ID
Protein Name
Photosystem I reaction center subunit III
Ligand Name
CHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES
CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3PCQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3pcqA1e3pcqA2e3pcqB1e3pcqB2e3pcqC1e3pcqD1e3pcqE1e3pcqF1e3pcqI1e3pcqJ1e3pcqK1e3pcqL1e3pcqM1e3pcqX1
ECOD domains from experimental PDB structures interacting with ligand DB02133
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A401 | DB02133 | CLA | 3pcq | e3pcqF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 4fe1 | e4fe1F1 | F:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F11 | F1:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F21 | F2:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F31 | F3:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F41 | F4:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F51 | F5:1-141 |
| P0A401 | DB02133 | CLA | 5zf0 | e5zf0F61 | F6:1-141 |
| P0A401 | DB02133 | CLA | 6pfy | e6pfyF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 6pfy | e6pfyQ1 | Q:1-141 |
| P0A401 | DB02133 | CLA | 6pfy | e6pfyd1 | d:1-141 |
| P0A401 | DB02133 | CLA | 6pgk | e6pgkF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 6pgk | e6pgkQ1 | Q:1-141 |
| P0A401 | DB02133 | CLA | 6pgk | e6pgkd1 | d:1-141 |
| P0A401 | DB02133 | CLA | 6tra | e6traF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 6trc | e6trc61 | 6:1-141 |
| P0A401 | DB02133 | CLA | 6trc | e6trcF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 6trc | e6trcf1 | f:1-141 |
| P0A401 | DB02133 | CLA | 6trd | e6trd61 | 6:1-141 |
| P0A401 | DB02133 | CLA | 6trd | e6trdF1 | F:1-141 |
| P0A401 | DB02133 | CLA | 6trd | e6trdf1 | f:1-141 |
| P0A401 | DB02133 | CLA | 7fix | e7fixF11 | F1:24-164 |
| P0A401 | DB02133 | CLA | 7fix | e7fixF21 | F2:24-164 |
| P0A401 | DB02133 | CLA | 7fix | e7fixF31 | F3:24-164 |
| P0A401 | DB02133 | CLA | 7m75 | e7m75F1 | F:1-141 |
| P0A401 | DB02133 | CLA | 7m76 | e7m76F1 | F:1-141 |
| P0A401 | DB02133 | CLA | 7m78 | e7m78F1 | F:1-141 |