Attributes
UniProt ID
Protein Name
Photosystem I reaction center subunit IX
Ligand Name
PHYLLOQUINONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MBWXNTAXLNYFJB-NKFFZRIASA-N
SMILES
CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCCC(C)CCCC(C)CCCC(C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3PCQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3pcqA1e3pcqA2e3pcqB1e3pcqB2e3pcqC1e3pcqD1e3pcqE1e3pcqF1e3pcqI1e3pcqJ1e3pcqK1e3pcqL1e3pcqM1e3pcqX1
ECOD domains from experimental PDB structures interacting with ligand DB01022
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A429 | DB01022 | PQN | 3pcq | e3pcqJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 4fe1 | e4fe1J1 | J:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J11 | J1:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J21 | J2:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J31 | J3:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J41 | J4:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J51 | J5:1-41 |
| P0A429 | DB01022 | PQN | 5zf0 | e5zf0J61 | J6:1-41 |
| P0A429 | DB01022 | PQN | 6pfy | e6pfyJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 6pfy | e6pfyS1 | S:1-41 |
| P0A429 | DB01022 | PQN | 6pfy | e6pfyf1 | f:1-41 |
| P0A429 | DB01022 | PQN | 6pgk | e6pgkJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 6pgk | e6pgkS1 | S:1-41 |
| P0A429 | DB01022 | PQN | 6pgk | e6pgkf1 | f:1-41 |
| P0A429 | DB01022 | PQN | 6tra | e6traJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 6trc | e6trc81 | 8:1-41 |
| P0A429 | DB01022 | PQN | 6trc | e6trcJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 6trc | e6trcj1 | j:1-41 |
| P0A429 | DB01022 | PQN | 6trd | e6trd81 | 8:1-41 |
| P0A429 | DB01022 | PQN | 6trd | e6trdJ1 | J:1-41 |
| P0A429 | DB01022 | PQN | 6trd | e6trdj1 | j:1-41 |
| P0A429 | DB01022 | PQN | 7fix | e7fixJ11 | J1:1-41 |
| P0A429 | DB01022 | PQN | 7fix | e7fixJ21 | J2:1-41 |
| P0A429 | DB01022 | PQN | 7fix | e7fixJ31 | J3:1-41 |
| P0A429 | DB01022 | PQN | 7m75 | e7m75J1 | J:1-41 |
| P0A429 | DB01022 | PQN | 7m76 | e7m76J1 | J:1-41 |
| P0A429 | DB01022 | PQN | 7m78 | e7m78J1 | J:1-41 |