Attributes
UniProt ID
Protein Name
UDP-N-acetylglucosamine 1-carboxyvinyltransferase
Ligand Name
(2R)-2-{[(2R,3R,4R,5S,6R)-3-(acetylamino)-2-{[(S)-{[(R)-{[(2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]oxy}-5-hydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-4-yl]oxy}propanoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NQBRVZNDBBMBLJ-MQTLHLSBSA-N
SMILES
CC(C(=O)O)OC1C(C(OC(C1O)CO)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)NC(=O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3SWD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3swdA1e3swdA2e3swdB1e3swdB2e3swdC1e3swdC2e3swdD1e3swdD2e3swdE1e3swdE2e3swdF1e3swdF2e3swdG1e3swdG2e3swdH1e3swdH2e3swdI1e3swdI2e3swdJ1e3swdJ2e3swdK1e3swdK2e3swdL1e3swdL2
ECOD domains from experimental PDB structures interacting with ligand EPZ
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A749 | n/a | EPZ | 3swd | e3swdA1 | A:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdA2 | A:1-20,A:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdB1 | B:1-20,B:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdB2 | B:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdC1 | C:1-20,C:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdC2 | C:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdD1 | D:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdD2 | D:1-20,D:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdE1 | E:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdE2 | E:1-20,E:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdF1 | F:1-20,F:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdF2 | F:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdG1 | G:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdG2 | G:1-20,G:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdH1 | H:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdH2 | H:1-20,H:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdI1 | I:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdI2 | I:1-20,I:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdJ1 | J:1-20,J:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdJ2 | J:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdK1 | K:21-229 |
| P0A749 | n/a | EPZ | 3swd | e3swdK2 | K:1-20,K:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdL1 | L:1-20,L:230-418 |
| P0A749 | n/a | EPZ | 3swd | e3swdL2 | L:21-229 |