Attributes
UniProt ID
Protein Name
Protein RecA
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1N03
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1n03A1e1n03A2e1n03B1e1n03B2e1n03C1e1n03C2e1n03D1e1n03D2e1n03E1e1n03E2e1n03F1e1n03F2e1n03G1e1n03G2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03A1 | A:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03B1 | B:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03C1 | C:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03D1 | D:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03E1 | E:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03F1 | F:3-269 |
| P0A7G6 | DB16833 | ADP | 1n03 | e1n03G1 | G:3-269 |
| P0A7G6 | DB16833 | ADP | 1rea | e1reaA2 | A:6-268 |
| P0A7G6 | DB16833 | ADP | 1xmv | e1xmvA2 | A:3-268 |
| P0A7G6 | DB16833 | ADP | 3cmt | e3cmtA13 | A:3334-4269 |
| P0A7G6 | DB16833 | ADP | 3cmt | e3cmtD13 | D:3334-4269 |
| P0A7G6 | DB16833 | ADP | 3cmu | e3cmuA11 | A:5001-5269 |
| P0A7G6 | DB16833 | ADP | 3cmw | e3cmwA13 | A:3334-4269 |
| P0A7G6 | DB16833 | ADP | 3cmw | e3cmwC13 | C:3334-4269 |
| P0A7G6 | DB16833 | ADP | 3cmx | e3cmxA13 | A:3334-4269 |
| P0A7G6 | DB16833 | ADP | 3cmx | e3cmxD13 | D:3334-4269 |