Attributes
UniProt ID
Protein Name
NADH dehydrogenase H:quinone oxidoreductase
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2R96
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2r96A1e2r96C1
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A8G6 | DB03247 | FMN | 2r96 | e2r96A1 | A:1-197 |
| P0A8G6 | DB03247 | FMN | 2r96 | e2r96C1 | C:1-197 |
| P0A8G6 | DB03247 | FMN | 2r97 | e2r97A1 | A:1-197 |
| P0A8G6 | DB03247 | FMN | 2r97 | e2r97C1 | C:1-197 |
| P0A8G6 | DB03247 | FMN | 3b6i | e3b6iA1 | A:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6i | e3b6iB1 | B:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6j | e3b6jA1 | A:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6j | e3b6jB1 | B:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6k | e3b6kA1 | A:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6k | e3b6kB1 | B:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6m | e3b6mA1 | A:2-198 |
| P0A8G6 | DB03247 | FMN | 3b6m | e3b6mB1 | B:2-198 |
| P0A8G6 | DB03247 | FMN | 3zho | e3zhoA1 | A:1-197 |
| P0A8G6 | DB03247 | FMN | 3zho | e3zhoB1 | B:1-197 |
| P0A8G6 | DB03247 | FMN | 4yqe | e4yqeA1 | A:1-197 |
| P0A8G6 | DB03247 | FMN | 4yqe | e4yqeB1 | B:1-197 |
| P0A8G6 | DB03247 | FMN | 5f12 | e5f12A1 | A:1-197 |
| P0A8G6 | DB03247 | FMN | 5f12 | e5f12B1 | B:1-197 |