Attributes
UniProt ID
Protein Name
Met repressor
Ligand Name
S-ADENOSYLMETHIONINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MEFKEPWMEQBLKI-FCKMPRQPSA-N
SMILES
C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1CMA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1cmaA1e1cmaB1
ECOD domains from experimental PDB structures interacting with ligand DB00118
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A8U6 | DB00118 | SAM | 1cma | e1cmaA1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1cma | e1cmaB1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1cmc | e1cmcA1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1cmc | e1cmcB1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1mj2 | e1mj2A1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1mj2 | e1mj2B1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1mj2 | e1mj2C1 | C:1-104 |
| P0A8U6 | DB00118 | SAM | 1mj2 | e1mj2D1 | D:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjl | e1mjlA1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjl | e1mjlB1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjo | e1mjoA1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjo | e1mjoB1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjo | e1mjoC1 | C:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjo | e1mjoD1 | D:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqA1 | A:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqB1 | B:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqC1 | C:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqD1 | D:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqG1 | G:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqH1 | H:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqI1 | I:1-104 |
| P0A8U6 | DB00118 | SAM | 1mjq | e1mjqJ1 | J:1-104 |