Attributes
UniProt ID
Protein Name
Inducible lysine decarboxylase
Ligand Name
GUANOSINE-5',3'-TETRAPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BUFLLCUFNHESEH-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)OP(=O)(O)OP(=O)(O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3N75
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3n75A4e3n75A5e3n75A6e3n75A7e3n75B3e3n75B5e3n75B6e3n75B7e3n75C3e3n75C5e3n75C6e3n75C7e3n75D3e3n75D5e3n75D6e3n75D7e3n75E3e3n75E5e3n75E6e3n75E7
ECOD domains from experimental PDB structures interacting with ligand DB04022
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75A4 | A:1-129 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75A5 | A:130-417 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75A6 | A:563-711 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75A7 | A:418-562 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75B3 | B:1-129 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75B5 | B:130-417 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75B6 | B:563-711 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75B7 | B:418-562 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75C3 | C:1-129 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75C5 | C:130-417 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75C6 | C:563-711 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75C7 | C:418-562 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75D3 | D:1-129 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75D5 | D:130-417 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75D6 | D:563-711 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75D7 | D:418-562 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75E3 | E:1-129 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75E5 | E:130-417 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75E6 | E:563-711 |
| P0A9H3 | DB04022 | G4P | 3n75 | e3n75E7 | E:418-562 |