Attributes
UniProt ID
Protein Name
Branched-chain-amino-acid aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1A3G
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1a3gA1e1a3gA2e1a3gB1e1a3gB2e1a3gC1e1a3gC2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gA1 | A:137-306 |
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gA2 | A:4-126 |
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gB1 | B:137-306 |
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gB2 | B:4-126 |
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gC1 | C:137-306 |
| P0AB80 | DB00114 | PLP | 1a3g | e1a3gC2 | C:4-126 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kA1 | A:134-306 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kA2 | A:4-126 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kB1 | B:634-806 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kB2 | B:504-626 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kC1 | C:1134-1306 |
| P0AB80 | DB00114 | PLP | 1i1k | e1i1kC2 | C:1004-1126 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mA1 | A:128-306 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mA2 | A:4-127 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mB1 | B:628-806 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mB2 | B:504-627 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mC1 | C:1128-1306 |
| P0AB80 | DB00114 | PLP | 1i1m | e1i1mC2 | C:1004-1127 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydA1 | A:128-306 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydA2 | A:4-127 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydB1 | B:128-306 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydB2 | B:4-127 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydC1 | C:128-306 |
| P0AB80 | DB00114 | PLP | 1iyd | e1iydC2 | C:4-127 |