Attributes
UniProt ID
Protein Name
Soluble cytochrome b562
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4OR2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4or2A1e4or2A2e4or2B1e4or2B2
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0ABE7 | DB04540 | CLR | 4or2 | e4or2A1 | A:581-843 |
| P0ABE7 | DB04540 | CLR | 4or2 | e4or2B1 | B:581-846 |
| P0ABE7 | DB04540 | CLR | 6b73 | e6b73A1 | A:51-339 |
| P0ABE7 | DB04540 | CLR | 6b73 | e6b73B1 | B:54-334 |
| P0ABE7 | DB04540 | CLR | 6iiu | e6iiuA2 | A:11-323 |
| P0ABE7 | DB04540 | CLR | 6iiv | e6iivA2 | A:11-323 |
| P0ABE7 | DB04540 | CLR | 6lw5 | e6lw5A1 | A:24-322 |
| P0ABE7 | DB04540 | CLR | 7e2x | e7e2xR1 | R:35-226,R:335-415 |
| P0ABE7 | DB04540 | CLR | 7e2y | e7e2yR1 | R:35-226,R:335-415 |
| P0ABE7 | DB04540 | CLR | 7e2z | e7e2zR1 | R:35-226,R:335-415 |
| P0ABE7 | DB04540 | CLR | 7e32 | e7e32R1 | R:34-229,R:292-371 |
| P0ABE7 | DB04540 | CLR | 7t2g | e7t2gR1 | R:65-352 |
| P0ABE7 | DB04540 | CLR | 7xt8 | e7xt8R1 | R:18-328 |
| P0ABE7 | DB04540 | CLR | 7xt9 | e7xt9R1 | R:18-328 |
| P0ABE7 | DB04540 | CLR | 7xtc | e7xtcR1 | R:80-274,R:324-403 |
| P0ABE7 | DB04540 | CLR | 8hnk | e8hnkR1 | R:40-336 |
| P0ABE7 | DB04540 | CLR | 8hnl | e8hnlR1 | R:42-336 |
| P0ABE7 | DB04540 | CLR | 8hnm | e8hnmR1 | R:60-336 |
| P0ABE7 | DB04540 | CLR | 8hnn | e8hnnR1 | R:54-331 |
| P0ABE7 | DB04540 | CLR | 8irv | e8irvR1 | R:37-183,R:215-374 |
| P0ABE7 | DB04540 | CLR | 8k2w | e8k2wR1 | R:54-338 |
| P0ABE7 | DB04540 | CLR | 8k2x | e8k2xR1 | R:47-336 |
| P0ABE7 | DB04540 | CLR | 8w8b | e8w8bR1 | R:35-226,R:335-415 |