Attributes
UniProt ID
Protein Name
Cytochrome c-552
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2RDZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2rdzA1e2rdzB1e2rdzC1e2rdzD1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0ABK9 | DB03317 | HEC | 2rdz | e2rdzA1 | A:38-477 |
| P0ABK9 | DB03317 | HEC | 2rdz | e2rdzB1 | B:38-477 |
| P0ABK9 | DB03317 | HEC | 2rdz | e2rdzC1 | C:38-477 |
| P0ABK9 | DB03317 | HEC | 2rdz | e2rdzD1 | D:38-477 |
| P0ABK9 | DB03317 | HEC | 2rf7 | e2rf7A1 | A:37-477 |
| P0ABK9 | DB03317 | HEC | 2rf7 | e2rf7B1 | B:37-477 |
| P0ABK9 | DB03317 | HEC | 2rf7 | e2rf7C1 | C:37-477 |
| P0ABK9 | DB03317 | HEC | 2rf7 | e2rf7D1 | D:37-477 |
| P0ABK9 | DB03317 | HEC | 3l1t | e3l1tA1 | A:37-477 |
| P0ABK9 | DB03317 | HEC | 3l1t | e3l1tB1 | B:37-477 |
| P0ABK9 | DB03317 | HEC | 3l1t | e3l1tC1 | C:37-477 |
| P0ABK9 | DB03317 | HEC | 3l1t | e3l1tD1 | D:37-477 |
| P0ABK9 | DB03317 | HEC | 3tor | e3torA1 | A:37-477 |
| P0ABK9 | DB03317 | HEC | 3tor | e3torB1 | B:37-477 |
| P0ABK9 | DB03317 | HEC | 3tor | e3torC1 | C:37-477 |
| P0ABK9 | DB03317 | HEC | 3tor | e3torD1 | D:37-477 |
| P0ABK9 | DB03317 | HEC | 4wjy | e4wjyA1 | A:37-477 |
| P0ABK9 | DB03317 | HEC | 4wjy | e4wjyB1 | B:37-477 |