Attributes
UniProt ID
Protein Name
Glyoxylate carboligase
Ligand Name
3-[(4-AMINO-2-METHYLPYRIMIDIN-5-YL)METHYL]-2-{(1S)-1-HYDROXY-1-[(R)-HYDROXY(METHOXY)PHOSPHORYL]ETHYL}-5-(2-{[(S)-HYDROXY(PHOSPHONOOXY)PHOSPHORYL]OXY}ETHYL)-4-METHYL-1,3-THIAZOL-3-IUM
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ILGXNMPRCMTAOK-HNNXBMFYSA-O
SMILES
Cc1c(sc([n+]1Cc2cnc(nc2N)C)C(C)(O)P(=O)(O)OC)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8BEO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8beoA1e8beoA2e8beoA3e8beoB1e8beoB2e8beoB3e8beoC1e8beoC2e8beoC3e8beoD1e8beoD2e8beoD3e8beoE1e8beoE2e8beoE3e8beoF1e8beoF2e8beoF3
ECOD domains from experimental PDB structures interacting with ligand TDK
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0AEP7 | n/a | TDK | 8beo | e8beoA1 | A:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoA2 | A:185-362 |
| P0AEP7 | n/a | TDK | 8beo | e8beoA3 | A:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoB1 | B:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoB2 | B:185-362 |
| P0AEP7 | n/a | TDK | 8beo | e8beoB3 | B:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoC1 | C:185-362 |
| P0AEP7 | n/a | TDK | 8beo | e8beoC2 | C:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoC3 | C:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoD1 | D:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoD2 | D:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoD3 | D:185-362 |
| P0AEP7 | n/a | TDK | 8beo | e8beoE1 | E:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoE2 | E:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoE3 | E:185-362 |
| P0AEP7 | n/a | TDK | 8beo | e8beoF1 | F:2-184 |
| P0AEP7 | n/a | TDK | 8beo | e8beoF2 | F:363-593 |
| P0AEP7 | n/a | TDK | 8beo | e8beoF3 | F:185-362 |