Attributes
UniProt ID
Protein Name
Transcription termination factor Rho
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5JJI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5jjiA1e5jjiA2e5jjiA3e5jjiB1e5jjiB2e5jjiB3e5jjiC1e5jjiC2e5jjiC3e5jjiD1e5jjiD2e5jjiD3e5jjiE1e5jjiE2e5jjiE3e5jjiF1e5jjiF2e5jjiF3
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0AG32 | DB16833 | ADP | 5jji | e5jjiA2 | A:129-416 |
| P0AG32 | DB16833 | ADP | 5jji | e5jjiB2 | B:128-417 |
| P0AG32 | DB16833 | ADP | 5jji | e5jjiC3 | C:128-417 |
| P0AG32 | DB16833 | ADP | 5jji | e5jjiD2 | D:128-416 |
| P0AG32 | DB16833 | ADP | 5jji | e5jjiE3 | E:128-416 |
| P0AG32 | DB16833 | ADP | 5jji | e5jjiF1 | F:128-416 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkA1 | A:129-416 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkB1 | B:128-417 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkC1 | C:128-417 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkD2 | D:128-416 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkE1 | E:128-416 |
| P0AG32 | DB16833 | ADP | 5jjk | e5jjkF1 | F:128-416 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlA3 | A:129-416 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlB3 | B:128-417 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlC2 | C:128-417 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlD3 | D:128-416 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlE3 | E:128-405 |
| P0AG32 | DB16833 | ADP | 5jjl | e5jjlF1 | F:128-416 |