Attributes
UniProt ID
Protein Name
Succinate--CoA ligase subunit alpha
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2NU6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2nu6A1e2nu6A2e2nu6B1e2nu6B2e2nu6D1e2nu6D2e2nu6E1e2nu6E2
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0AGE9 | DB01992 | COA | 2nu6 | e2nu6A1 | A:2-120 |
| P0AGE9 | DB01992 | COA | 2nu6 | e2nu6A2 | A:122-287 |
| P0AGE9 | DB01992 | COA | 2nu6 | e2nu6D1 | D:2-120 |
| P0AGE9 | DB01992 | COA | 2nu6 | e2nu6D2 | D:122-287 |
| P0AGE9 | DB01992 | COA | 2nu7 | e2nu7A1 | A:2-120 |
| P0AGE9 | DB01992 | COA | 2nu7 | e2nu7A2 | A:122-287 |
| P0AGE9 | DB01992 | COA | 2nu7 | e2nu7D1 | D:2-120 |
| P0AGE9 | DB01992 | COA | 2nu7 | e2nu7D2 | D:122-287 |
| P0AGE9 | DB01992 | COA | 2nu8 | e2nu8A1 | A:2-120 |
| P0AGE9 | DB01992 | COA | 2nu8 | e2nu8A2 | A:122-287 |
| P0AGE9 | DB01992 | COA | 2nu8 | e2nu8D1 | D:2-120 |
| P0AGE9 | DB01992 | COA | 2nu8 | e2nu8D2 | D:122-287 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9A1 | A:2-120 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9A2 | A:122-286 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9D1 | D:2-120 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9D2 | D:122-286 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9F1 | F:2-120 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9F2 | F:122-286 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9H1 | H:2-120 |
| P0AGE9 | DB01992 | COA | 2nu9 | e2nu9H2 | H:122-286 |
| P0AGE9 | DB01992 | COA | 2nua | e2nuaA1 | A:2-120 |
| P0AGE9 | DB01992 | COA | 2nua | e2nuaA2 | A:122-287 |
| P0AGE9 | DB01992 | COA | 2nua | e2nuaD1 | D:2-120 |
| P0AGE9 | DB01992 | COA | 2nua | e2nuaD2 | D:122-287 |