Attributes
UniProt ID
Protein Name
Metalloprotease TldD
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5NJ9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5nj9A1e5nj9A2e5nj9A3e5nj9B1e5nj9B2e5nj9B3e5nj9C1e5nj9C2e5nj9C3e5nj9D1e5nj9D2e5nj9D3
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0AGG8 | DB03814 | MES | 5nj9 | e5nj9A1 | A:101-239 |
| P0AGG8 | DB03814 | MES | 5nj9 | e5nj9A2 | A:2-100 |
| P0AGG8 | DB03814 | MES | 5nj9 | e5nj9C2 | C:101-239 |
| P0AGG8 | DB03814 | MES | 5nj9 | e5nj9C3 | C:2-100 |
| P0AGG8 | DB03814 | MES | 5nja | e5njaA1 | A:101-239 |
| P0AGG8 | DB03814 | MES | 5nja | e5njaA2 | A:2-100 |
| P0AGG8 | DB03814 | MES | 5nja | e5njaC2 | C:101-239 |
| P0AGG8 | DB03814 | MES | 5nja | e5njaC3 | C:2-100 |
| P0AGG8 | DB03814 | MES | 5njb | e5njbA1 | A:2-100 |
| P0AGG8 | DB03814 | MES | 5njb | e5njbA2 | A:101-239 |
| P0AGG8 | DB03814 | MES | 5njb | e5njbC1 | C:3-100 |
| P0AGG8 | DB03814 | MES | 5njb | e5njbC2 | C:101-239 |
| P0AGG8 | DB03814 | MES | 5njc | e5njcA1 | A:3-100 |
| P0AGG8 | DB03814 | MES | 5njc | e5njcA2 | A:101-239 |
| P0AGG8 | DB03814 | MES | 5njc | e5njcC1 | C:101-239 |
| P0AGG8 | DB03814 | MES | 5njc | e5njcC3 | C:2-100 |
| P0AGG8 | DB03814 | MES | 5njf | e5njfA2 | A:101-239 |
| P0AGG8 | DB03814 | MES | 5njf | e5njfA3 | A:2-100 |
| P0AGG8 | DB03814 | MES | 5njf | e5njfC1 | C:101-239 |
| P0AGG8 | DB03814 | MES | 5njf | e5njfC3 | C:2-100 |