Attributes
UniProt ID
Protein Name
Reaction center protein M chain
Ligand Name
SPHEROIDENE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES
CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2J8C
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2j8cH1e2j8cH2e2j8cL1e2j8cM1
ECOD domains from experimental PDB structures interacting with ligand SPO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0C0Y9 | n/a | SPO | 2j8c | e2j8cM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2j8d | e2j8dM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uws | e2uwsM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uwt | e2uwtM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uwu | e2uwuM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uwv | e2uwvM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uww | e2uwwM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2ux3 | e2ux3M1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2ux4 | e2ux4M1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2ux5 | e2ux5M1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uxj | e2uxjM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uxk | e2uxkM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uxl | e2uxlM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 2uxm | e2uxmM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 3i4d | e3i4dM1 | M:1-302 |
| P0C0Y9 | n/a | SPO | 4h99 | e4h99M1 | M:1-302 |
| P0C0Y9 | n/a | SPO | 4h9l | e4h9lM1 | M:1-301 |
| P0C0Y9 | n/a | SPO | 4hbh | e4hbhM1 | M:1-301 |
| P0C0Y9 | n/a | SPO | 4hbj | e4hbjM1 | M:1-302 |
| P0C0Y9 | n/a | SPO | 4in5 | e4in5M1 | M:1-302 |
| P0C0Y9 | n/a | SPO | 4in6 | e4in6M1 | M:1-302 |
| P0C0Y9 | n/a | SPO | 4in7 | e4in7M1 | M:0-301 |
| P0C0Y9 | n/a | SPO | 4n7k | e4n7kM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 4n7l | e4n7lM1 | M:1-303 |
| P0C0Y9 | n/a | SPO | 4v9g | e4v9gAM1 | AM:1-304 |
| P0C0Y9 | n/a | SPO | 7mh3 | e7mh3M1 | M:2-302 |
| P0C0Y9 | n/a | SPO | 7mh4 | e7mh4M1 | M:3-302 |
| P0C0Y9 | n/a | SPO | 7mh5 | e7mh5M1 | M:3-302 |
| P0C0Y9 | n/a | SPO | 7mh8 | e7mh8M1 | M:2-302 |
| P0C0Y9 | n/a | SPO | 7mh9 | e7mh9M1 | M:2-302 |
| P0C0Y9 | n/a | SPO | 7mha | e7mhaM1 | M:2-302 |