Attributes
UniProt ID
Protein Name
Ribulose bisphosphate carboxylase large chain
Ligand Name
6-PHOSPHOGLUCONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BIRSGZKFKXLSJQ-SQOUGZDYSA-N
SMILES
C(C(C(C(C(C(=O)O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3AXM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3axmA3e3axmA4e3axmB3e3axmB4e3axmC3e3axmC4e3axmD3e3axmD4e3axmE3e3axmE4e3axmF3e3axmF4e3axmG3e3axmG4e3axmH3e3axmH4e3axmS2e3axmT2e3axmU2e3axmV2e3axmW2e3axmX2e3axmY2e3axmZ2
ECOD domains from experimental PDB structures interacting with ligand DB02076
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0C512 | DB02076 | 6PG | 3axm | e3axmA3 | A:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmA4 | A:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmB3 | B:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmB4 | B:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmC3 | C:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmC4 | C:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmD3 | D:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmD4 | D:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmE3 | E:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmE4 | E:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmF3 | F:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmF4 | F:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmG3 | G:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmG4 | G:149-463 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmH3 | H:12-150 |
| P0C512 | DB02076 | 6PG | 3axm | e3axmH4 | H:149-463 |