Attributes
UniProt ID
Protein Name
Cys-loop ligand-gated ion channel
Ligand Name
Bromomemantine
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UKCUZUGMIJFTKF-IWDIQUIJSA-N
SMILES
CC12CC3(CC(C1)(CC(C2)(C3)Br)N)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4TWF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4twfA1e4twfA2e4twfB1e4twfB2e4twfC1e4twfC2e4twfD1e4twfD2e4twfE1e4twfE2e4twfF1e4twfF2e4twfG1e4twfG2e4twfH1e4twfH2e4twfI1e4twfI2e4twfJ1e4twfJ2
ECOD domains from experimental PDB structures interacting with ligand BR7
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0C7B7 | n/a | BR7 | 4twf | e4twfA1 | A:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfA2 | A:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfB1 | B:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfB2 | B:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfC1 | C:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfC2 | C:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfD1 | D:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfD2 | D:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfE1 | E:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfE2 | E:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfF1 | F:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfF2 | F:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfG1 | G:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfG2 | G:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfH1 | H:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfH2 | H:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfI1 | I:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfI2 | I:11-199 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfJ1 | J:200-317 |
| P0C7B7 | n/a | BR7 | 4twf | e4twfJ2 | J:11-199 |