Attributes
UniProt ID
Protein Name
Cys-loop ligand-gated ion channel
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5SXV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5sxvA1e5sxvA2e5sxvB1e5sxvB2e5sxvC1e5sxvC2e5sxvD1e5sxvD2e5sxvE1e5sxvE2e5sxvF1e5sxvF2e5sxvG1e5sxvG2e5sxvH1e5sxvH2e5sxvI1e5sxvI2e5sxvJ1e5sxvJ2
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvA1 | A:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvB1 | B:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvB2 | B:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvC2 | C:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvD1 | D:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvD2 | D:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvE1 | E:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvE2 | E:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvF1 | F:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvF2 | F:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvG1 | G:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvG2 | G:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvH2 | H:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvI1 | I:200-317 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvI2 | I:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvJ1 | J:10-202 |
| P0C7B7 | DB03814 | MES | 5sxv | e5sxvJ2 | J:200-317 |
| P0C7B7 | DB03814 | MES | 6hjx | e6hjxB2 | B:6-202 |
| P0C7B7 | DB03814 | MES | 6hjx | e6hjxC1 | C:6-202 |
| P0C7B7 | DB03814 | MES | 6ssi | e6ssiA2 | A:9-202 |
| P0C7B7 | DB03814 | MES | 6ssi | e6ssiB1 | B:7-202 |
| P0C7B7 | DB03814 | MES | 6ssi | e6ssiC2 | C:7-202 |
| P0C7B7 | DB03814 | MES | 6ssi | e6ssiD1 | D:7-202 |
| P0C7B7 | DB03814 | MES | 6ssi | e6ssiE2 | E:9-202 |