Attributes
UniProt ID
Protein Name
Glyceraldehyde-3-phosphate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6OK4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ok4A1e6ok4A2e6ok4B1e6ok4B2e6ok4C1e6ok4C2e6ok4D1e6ok4D2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4A1 | A:-1-149,A:314-332 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4A2 | A:150-313 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4B1 | B:150-313 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4B2 | B:0-149,B:314-332 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4C1 | C:-1-149,C:314-332 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4C2 | C:150-313 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4D1 | D:150-313 |
| P0CE13 | DB14128 | NAD | 6ok4 | e6ok4D2 | D:-1-149,D:314-332 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycA1 | A:150-313 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycA2 | A:1-149,A:314-333 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycB1 | B:1-149,B:314-333 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycB2 | B:150-313 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycC1 | C:1-149,C:314-333 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycC2 | C:150-313 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycD1 | D:1-149,D:314-332 |
| P0CE13 | DB14128 | NAD | 6wyc | e6wycD2 | D:150-313 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eA1 | A:150-313 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eA2 | A:1-149,A:314-333 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eB2 | B:150-313 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eC1 | C:1-149,C:314-333 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eC2 | C:150-313 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eD1 | D:1-149,D:314-332 |
| P0CE13 | DB14128 | NAD | 6x2e | e6x2eD2 | D:150-313 |