Attributes
UniProt ID
Protein Name
Heat shock 70 kDa protein 1A
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5BN9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5bn9A1e5bn9A2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0DMV8 | DB16833 | ADP | 5bn9 | e5bn9A1 | A:189-382 |
| P0DMV8 | DB16833 | ADP | 5bn9 | e5bn9A2 | A:4-188 |
| P0DMV8 | DB16833 | ADP | 5bpl | e5bplA1 | A:189-382 |
| P0DMV8 | DB16833 | ADP | 5bpl | e5bplA2 | A:3-188 |
| P0DMV8 | DB16833 | ADP | 6fhk | e6fhkA1 | A:4-188 |
| P0DMV8 | DB16833 | ADP | 6fhk | e6fhkA2 | A:189-381 |
| P0DMV8 | DB16833 | ADP | 6fhk | e6fhkB1 | B:189-381 |
| P0DMV8 | DB16833 | ADP | 6fhk | e6fhkB2 | B:4-188 |
| P0DMV8 | DB16833 | ADP | 6g3r | e6g3rA1 | A:3-188 |
| P0DMV8 | DB16833 | ADP | 6g3r | e6g3rA2 | A:189-382 |
| P0DMV8 | DB16833 | ADP | 6g3s | e6g3sA1 | A:189-382 |
| P0DMV8 | DB16833 | ADP | 6g3s | e6g3sA2 | A:4-188 |
| P0DMV8 | DB16833 | ADP | 7fgm | e7fgmA1 | A:189-381 |
| P0DMV8 | DB16833 | ADP | 7fgm | e7fgmA2 | A:2-188 |
| P0DMV8 | DB16833 | ADP | 7kw7 | e7kw7C1 | C:4-187 |
| P0DMV8 | DB16833 | ADP | 7kw7 | e7kw7C2 | C:188-385 |
| P0DMV8 | DB16833 | ADP | 7kw7 | e7kw7D1 | D:4-187 |
| P0DMV8 | DB16833 | ADP | 7kw7 | e7kw7D2 | D:188-382 |