Attributes
UniProt ID
Protein Name
Replicase polyprotein 1ab
Ligand Name
N-[(benzyloxy)carbonyl]-L-leucyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-L-leucinamide
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WUJQMWDTZKIKQZ-VABKMULXSA-N
SMILES
CC(C)CC(CO)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)OCc1ccccc1
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7BE7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7be7A1e7be7A2e7be7B1e7be7B2
ECOD domains from experimental PDB structures interacting with ligand ALD
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0DTD1 | n/a | ALD | 7be7 | e7be7A1 | A:187-302 |
| P0DTD1 | n/a | ALD | 7be7 | e7be7A2 | A:1-186 |
| P0DTD1 | n/a | ALD | 7be7 | e7be7B1 | B:1-186 |
| P0DTD1 | n/a | ALD | 7be7 | e7be7B2 | B:187-305 |
| P0DTD1 | n/a | ALD | 7bgp | e7bgpA1 | A:1-186 |
| P0DTD1 | n/a | ALD | 7bgp | e7bgpA2 | A:187-301 |
| P0DTD1 | n/a | ALD | 7bgp | e7bgpB1 | B:1-186 |
| P0DTD1 | n/a | ALD | 7bgp | e7bgpB2 | B:187-305 |
| P0DTD1 | n/a | ALD | 7cuu | e7cuuA1 | A:1-186 |
| P0DTD1 | n/a | ALD | 7cuu | e7cuuA2 | A:187-306 |
| P0DTD1 | n/a | ALD | 7cuu | e7cuuB1 | B:187-306 |
| P0DTD1 | n/a | ALD | 7cuu | e7cuuB2 | B:1-186 |
| P0DTD1 | n/a | ALD | 7nf5 | e7nf5A1 | A:1-186 |
| P0DTD1 | n/a | ALD | 7nf5 | e7nf5A2 | A:187-305 |
| P0DTD1 | n/a | ALD | 7ng3 | e7ng3A1 | A:187-302 |
| P0DTD1 | n/a | ALD | 7ng3 | e7ng3A2 | A:1-186 |
| P0DTD1 | n/a | ALD | 7ng3 | e7ng3B1 | B:187-306 |
| P0DTD1 | n/a | ALD | 7ng3 | e7ng3B2 | B:1-186 |
| P0DTD1 | n/a | ALD | 7ng6 | e7ng6A1 | A:187-302 |
| P0DTD1 | n/a | ALD | 7ng6 | e7ng6A2 | A:1-186 |
| P0DTD1 | n/a | ALD | 7ng6 | e7ng6B1 | B:1-186 |
| P0DTD1 | n/a | ALD | 7ng6 | e7ng6B2 | B:187-305 |
| P0DTD1 | n/a | ALD | 7wqk | e7wqkA1 | A:187-301 |
| P0DTD1 | n/a | ALD | 7wqk | e7wqkA2 | A:2-186 |