Attributes
UniProt ID
Protein Name
Replicase polyprotein 1ab
Ligand Name
S-ADENOSYLMETHIONINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MEFKEPWMEQBLKI-FCKMPRQPSA-N
SMILES
C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6W4H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6w4hA1e6w4hB1
ECOD domains from experimental PDB structures interacting with ligand DB00118
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P0DTD1 | DB00118 | SAM | 6w4h | e6w4hA1 | A:6798-7096 |
| P0DTD1 | DB00118 | SAM | 6w61 | e6w61A1 | A:6798-7096 |
| P0DTD1 | DB00118 | SAM | 6w75 | e6w75A1 | A:6800-7096 |
| P0DTD1 | DB00118 | SAM | 6w75 | e6w75C1 | C:6799-7095 |
| P0DTD1 | DB00118 | SAM | 6wks | e6wksAAA1 | AAA:1-298 |
| P0DTD1 | DB00118 | SAM | 6wvn | e6wvnA1 | A:6798-7096 |
| P0DTD1 | DB00118 | SAM | 7bq7 | e7bq7A1 | A:1-297 |
| P0DTD1 | DB00118 | SAM | 7c2i | e7c2iA1 | A:1-298 |
| P0DTD1 | DB00118 | SAM | 7c2j | e7c2jA1 | A:1-298 |
| P0DTD1 | DB00118 | SAM | 7jib | e7jibA1 | A:0-298 |
| P0DTD1 | DB00118 | SAM | 7jpe | e7jpeA1 | A:0-298 |
| P0DTD1 | DB00118 | SAM | 7jyy | e7jyyA1 | A:6797-7096 |
| P0DTD1 | DB00118 | SAM | 7jyy | e7jyyC1 | C:6799-7095 |
| P0DTD1 | DB00118 | SAM | 7koa | e7koaA1 | A:1-297 |
| P0DTD1 | DB00118 | SAM | 8osx | e8osxA1 | A:6799-7099 |
| P0DTD1 | DB00118 | SAM | 8otr | e8otrA1 | A:6799-7099 |
| P0DTD1 | DB00118 | SAM | 8ov1 | e8ov1A1 | A:6799-7099 |