Attributes
UniProt ID
Protein Name
Guanine nucleotide-binding protein G subunit alpha-1
Ligand Name
5'-GUANOSINE-DIPHOSPHATE-MONOTHIOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XOFLBQFBSOEHOG-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1AS0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1as0A1e1as0A2
ECOD domains from experimental PDB structures interacting with ligand DB01864
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P10824 | DB01864 | GSP | 1as0 | e1as0A1 | A:61-181 |
| P10824 | DB01864 | GSP | 1as0 | e1as0A2 | A:32-60,A:182-344 |
| P10824 | DB01864 | GSP | 1bh2 | e1bh2A1 | A:61-181 |
| P10824 | DB01864 | GSP | 1bh2 | e1bh2A2 | A:32-60,A:182-346 |
| P10824 | DB01864 | GSP | 1gia | e1giaA1 | A:61-181 |
| P10824 | DB01864 | GSP | 1gia | e1giaA2 | A:34-60,A:182-343 |
| P10824 | DB01864 | GSP | 1gil | e1gilA1 | A:61-181 |
| P10824 | DB01864 | GSP | 1gil | e1gilA2 | A:34-60,A:182-343 |
| P10824 | DB01864 | GSP | 3ffa | e3ffaA1 | A:61-181 |
| P10824 | DB01864 | GSP | 3ffa | e3ffaA2 | A:33-60,A:182-348 |
| P10824 | DB01864 | GSP | 4n0d | e4n0dA1 | A:45-165 |
| P10824 | DB01864 | GSP | 4n0d | e4n0dA2 | A:32-44,A:166-351 |
| P10824 | DB01864 | GSP | 4pao | e4paoA1 | A:33-60,A:175-348 |
| P10824 | DB01864 | GSP | 4pao | e4paoA2 | A:61-174 |
| P10824 | DB01864 | GSP | 4paq | e4paqA1 | A:33-60,A:175-348 |
| P10824 | DB01864 | GSP | 4paq | e4paqA2 | A:61-174 |
| P10824 | DB01864 | GSP | 5kdl | e5kdlA1 | A:33-60,A:182-346 |
| P10824 | DB01864 | GSP | 5kdl | e5kdlA2 | A:61-181 |
| P10824 | DB01864 | GSP | 5kdl | e5kdlB1 | B:61-181 |
| P10824 | DB01864 | GSP | 5kdl | e5kdlB2 | B:34-60,B:182-351 |
| P10824 | DB01864 | GSP | 6m8h | e6m8hA1 | A:61-181 |
| P10824 | DB01864 | GSP | 6m8h | e6m8hA2 | A:32-60,A:182-346 |