Attributes
UniProt ID
Protein Name
Actin-5C
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HF4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hf4A3e2hf4A4
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P10987 | DB00171 | ATP | 2hf4 | e2hf4A3 | A:2-139 |
| P10987 | DB00171 | ATP | 2hf4 | e2hf4A4 | A:140-375 |
| P10987 | DB00171 | ATP | 3eks | e3eksA3 | A:2-139 |
| P10987 | DB00171 | ATP | 3eks | e3eksA4 | A:140-375 |
| P10987 | DB00171 | ATP | 3eku | e3ekuA3 | A:4-139 |
| P10987 | DB00171 | ATP | 3eku | e3ekuA4 | A:140-375 |
| P10987 | DB00171 | ATP | 3el2 | e3el2A3 | A:4-139 |
| P10987 | DB00171 | ATP | 3el2 | e3el2A4 | A:140-375 |
| P10987 | DB00171 | ATP | 3mmv | e3mmvA3 | A:5-139 |
| P10987 | DB00171 | ATP | 3mmv | e3mmvA4 | A:140-375 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6A3 | A:5-139 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6A4 | A:140-375 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6F3 | F:5-139 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6F4 | F:140-375 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6K3 | K:5-139 |
| P10987 | DB00171 | ATP | 3mn6 | e3mn6K4 | K:140-375 |
| P10987 | DB00171 | ATP | 3mn7 | e3mn7A3 | A:5-139 |
| P10987 | DB00171 | ATP | 3mn7 | e3mn7A4 | A:140-375 |
| P10987 | DB00171 | ATP | 3mn9 | e3mn9A3 | A:5-139 |
| P10987 | DB00171 | ATP | 3mn9 | e3mn9A4 | A:140-375 |
| P10987 | DB00171 | ATP | 4m63 | e4m63C3 | C:6-139 |
| P10987 | DB00171 | ATP | 4m63 | e4m63C4 | C:140-374 |
| P10987 | DB00171 | ATP | 4m63 | e4m63D3 | D:5-139 |
| P10987 | DB00171 | ATP | 4m63 | e4m63D4 | D:140-374 |
| P10987 | DB00171 | ATP | 4m63 | e4m63E1 | E:6-139 |
| P10987 | DB00171 | ATP | 4m63 | e4m63E2 | E:140-374 |