Attributes
UniProt ID
Protein Name
Endoplasmic reticulum chaperone BiP
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3LDL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ldlA1e3ldlA2e3ldlB1e3ldlB2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11021 | DB00171 | ATP | 3ldl | e3ldlA1 | A:26-214 |
| P11021 | DB00171 | ATP | 3ldl | e3ldlA2 | A:215-406 |
| P11021 | DB00171 | ATP | 3ldl | e3ldlB1 | B:26-214 |
| P11021 | DB00171 | ATP | 3ldl | e3ldlB2 | B:215-406 |
| P11021 | DB00171 | ATP | 5e84 | e5e84A2 | A:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84A3 | A:216-412 |
| P11021 | DB00171 | ATP | 5e84 | e5e84B1 | B:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84B2 | B:216-412 |
| P11021 | DB00171 | ATP | 5e84 | e5e84C1 | C:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84C2 | C:216-412 |
| P11021 | DB00171 | ATP | 5e84 | e5e84D1 | D:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84D3 | D:216-412 |
| P11021 | DB00171 | ATP | 5e84 | e5e84E1 | E:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84E4 | E:216-412 |
| P11021 | DB00171 | ATP | 5e84 | e5e84F3 | F:24-215 |
| P11021 | DB00171 | ATP | 5e84 | e5e84F4 | F:216-412 |
| P11021 | DB00171 | ATP | 5f1x | e5f1xA1 | A:215-407 |
| P11021 | DB00171 | ATP | 5f1x | e5f1xA2 | A:26-214 |
| P11021 | DB00171 | ATP | 5f1x | e5f1xB1 | B:215-407 |
| P11021 | DB00171 | ATP | 5f1x | e5f1xB2 | B:27-214 |
| P11021 | DB00171 | ATP | 6asy | e6asyA2 | A:24-215 |
| P11021 | DB00171 | ATP | 6asy | e6asyA3 | A:216-412 |
| P11021 | DB00171 | ATP | 6asy | e6asyB1 | B:24-215 |
| P11021 | DB00171 | ATP | 6asy | e6asyB3 | B:216-412 |