Attributes
UniProt ID
Protein Name
RNA-directed RNA polymerase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1HI1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1hi1A1e1hi1A2e1hi1B1e1hi1B2e1hi1C1e1hi1C2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11124 | DB00171 | ATP | 1hi1 | e1hi1A1 | A:491-663 |
| P11124 | DB00171 | ATP | 1hi1 | e1hi1A2 | A:1-490 |
| P11124 | DB00171 | ATP | 1hi1 | e1hi1B1 | B:491-663 |
| P11124 | DB00171 | ATP | 1hi1 | e1hi1B2 | B:1-490 |
| P11124 | DB00171 | ATP | 1hi1 | e1hi1C1 | C:491-663 |
| P11124 | DB00171 | ATP | 1hi1 | e1hi1C2 | C:1-490 |
| P11124 | DB00171 | ATP | 4a8f | e4a8fA4 | A:1-491 |
| P11124 | DB00171 | ATP | 4a8f | e4a8fB3 | B:492-664 |
| P11124 | DB00171 | ATP | 4a8f | e4a8fB4 | B:1-491 |
| P11124 | DB00171 | ATP | 4a8f | e4a8fC3 | C:492-664 |
| P11124 | DB00171 | ATP | 4a8f | e4a8fC4 | C:1-491 |
| P11124 | DB00171 | ATP | 4a8m | e4a8mP4 | P:1-491 |
| P11124 | DB00171 | ATP | 4a8m | e4a8mQ4 | Q:1-491 |
| P11124 | DB00171 | ATP | 4a8m | e4a8mR4 | R:1-491 |
| P11124 | DB00171 | ATP | 4a8q | e4a8qA4 | A:1-491 |
| P11124 | DB00171 | ATP | 4a8q | e4a8qB4 | B:1-491 |
| P11124 | DB00171 | ATP | 4a8q | e4a8qC4 | C:1-491 |
| P11124 | DB00171 | ATP | 4a8s | e4a8sA4 | A:1-491 |
| P11124 | DB00171 | ATP | 4a8s | e4a8sB4 | B:1-491 |
| P11124 | DB00171 | ATP | 4a8s | e4a8sC4 | C:1-491 |
| P11124 | DB00171 | ATP | 4a8w | e4a8wA4 | A:1-491 |
| P11124 | DB00171 | ATP | 4a8w | e4a8wB4 | B:1-491 |
| P11124 | DB00171 | ATP | 4a8w | e4a8wC4 | C:1-491 |
| P11124 | DB00171 | ATP | 4a8y | e4a8yA4 | A:1-491 |
| P11124 | DB00171 | ATP | 4a8y | e4a8yB4 | B:1-491 |
| P11124 | DB00171 | ATP | 4a8y | e4a8yC4 | C:1-491 |