Attributes
UniProt ID
Protein Name
Packaging enzyme P4
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4BLO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4bloA1e4bloB1e4bloC1e4bloD1e4bloE1e4bloF1e4bloG1e4bloH1e4bloI1e4bloJ1e4bloK1e4bloL1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11125 | DB16833 | ADP | 4blo | e4bloA1 | A:2-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloB1 | B:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloC1 | C:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloD1 | D:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloE1 | E:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloF1 | F:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloG1 | G:1-275 |
| P11125 | DB16833 | ADP | 4blo | e4bloH1 | H:2-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloI1 | I:2-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloJ1 | J:1-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloK1 | K:2-276 |
| P11125 | DB16833 | ADP | 4blo | e4bloL1 | L:1-281 |
| P11125 | DB16833 | ADP | 5muv | e5muvA1 | A:2-276 |
| P11125 | DB16833 | ADP | 5muv | e5muvB1 | B:1-276 |
| P11125 | DB16833 | ADP | 5muv | e5muvI1 | I:2-276 |
| P11125 | DB16833 | ADP | 5muv | e5muvJ1 | J:1-276 |
| P11125 | DB16833 | ADP | 5muv | e5muvK1 | K:2-276 |
| P11125 | DB16833 | ADP | 5muv | e5muvL1 | L:1-281 |
| P11125 | DB16833 | ADP | 5muw | e5muwA1 | A:2-276 |
| P11125 | DB16833 | ADP | 5muw | e5muwB1 | B:1-276 |
| P11125 | DB16833 | ADP | 5muw | e5muwI1 | I:2-276 |
| P11125 | DB16833 | ADP | 5muw | e5muwJ1 | J:1-276 |
| P11125 | DB16833 | ADP | 5muw | e5muwK1 | K:2-276 |
| P11125 | DB16833 | ADP | 5muw | e5muwL1 | L:1-281 |