Attributes
UniProt ID
Protein Name
Uridine 5'-monophosphate synthase
Ligand Name
OROTIDINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KYOBSHFOBAOFBF-XVFCMESISA-N
SMILES
C1=C(N(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QCL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qclA1e2qclB1
ECOD domains from experimental PDB structures interacting with ligand DB02957
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11172 | DB02957 | OMP | 2qcl | e2qclA1 | A:224-478 |
| P11172 | DB02957 | OMP | 2qcl | e2qclB1 | B:223-479 |
| P11172 | DB02957 | OMP | 2wns | e2wnsA1 | A:7-203 |
| P11172 | DB02957 | OMP | 2wns | e2wnsB1 | B:8-206 |
| P11172 | DB02957 | OMP | 6yvk | e6yvkA1 | A:224-479 |
| P11172 | DB02957 | OMP | 6yvl | e6yvlA1 | A:224-479 |
| P11172 | DB02957 | OMP | 6yvm | e6yvmA1 | A:224-479 |
| P11172 | DB02957 | OMP | 6yvn | e6yvnA1 | A:224-479 |
| P11172 | DB02957 | OMP | 6yvo | e6yvoA1 | A:224-479 |
| P11172 | DB02957 | OMP | 6zx0 | e6zx0A1 | A:224-479 |
| P11172 | DB02957 | OMP | 7am9 | e7am9A1 | A:224-479 |
| P11172 | DB02957 | OMP | 7oqf | e7oqfA1 | A:224-479 |
| P11172 | DB02957 | OMP | 7oqf | e7oqfB1 | B:224-479 |
| P11172 | DB02957 | OMP | 7oqi | e7oqiA1 | A:224-479 |
| P11172 | DB02957 | OMP | 7oqi | e7oqiB1 | B:224-479 |
| P11172 | DB02957 | OMP | 7oqk | e7oqkA1 | A:224-479 |
| P11172 | DB02957 | OMP | 7oqk | e7oqkB1 | B:224-479 |
| P11172 | DB02957 | OMP | 7oqm | e7oqmA1 | A:224-479 |
| P11172 | DB02957 | OMP | 7oqm | e7oqmB1 | B:224-479 |
| P11172 | DB02957 | OMP | 7q1h | e7q1hA1 | A:223-480 |