Attributes
UniProt ID
Protein Name
Uridine 5'-monophosphate synthase
Ligand Name
URIDINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DJJCXFVJDGTHFX-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6YVK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6yvkA1
ECOD domains from experimental PDB structures interacting with ligand DB03685
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11172 | DB03685 | U | 6yvk | e6yvkA1 | A:224-479 |
| P11172 | DB03685 | U | 6yvl | e6yvlA1 | A:224-479 |
| P11172 | DB03685 | U | 6yvm | e6yvmA1 | A:224-479 |
| P11172 | DB03685 | U | 6yvn | e6yvnA1 | A:224-479 |
| P11172 | DB03685 | U | 6yvo | e6yvoA1 | A:224-479 |
| P11172 | DB03685 | U | 6zx0 | e6zx0A1 | A:224-479 |
| P11172 | DB03685 | U | 7am9 | e7am9A1 | A:224-479 |
| P11172 | DB03685 | U | 7oqf | e7oqfA1 | A:224-479 |
| P11172 | DB03685 | U | 7oqf | e7oqfB1 | B:224-479 |
| P11172 | DB03685 | U | 7oqi | e7oqiA1 | A:224-479 |
| P11172 | DB03685 | U | 7oqi | e7oqiB1 | B:224-479 |
| P11172 | DB03685 | U | 7oqk | e7oqkA1 | A:224-479 |
| P11172 | DB03685 | U | 7oqk | e7oqkB1 | B:224-479 |
| P11172 | DB03685 | U | 7oqm | e7oqmA1 | A:224-479 |
| P11172 | DB03685 | U | 7oqm | e7oqmB1 | B:224-479 |
| P11172 | DB03685 | U | 7oqn | e7oqnA1 | A:224-479 |
| P11172 | DB03685 | U | 7oqn | e7oqnB1 | B:224-479 |