Attributes
UniProt ID
Protein Name
Uridine 5'-monophosphate synthase
Ligand Name
URIDINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DJJCXFVJDGTHFX-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QCD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qcdA1e2qcdB1
ECOD domains from experimental PDB structures interacting with ligand DB03685
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11172 | DB03685 | U5P | 2qcd | e2qcdA1 | A:222-479 |
| P11172 | DB03685 | U5P | 2qcd | e2qcdB1 | B:222-479 |
| P11172 | DB03685 | U5P | 2qcn | e2qcnA1 | A:223-479 |
| P11172 | DB03685 | U5P | 2qcn | e2qcnB1 | B:223-479 |
| P11172 | DB03685 | U5P | 2v30 | e2v30A1 | A:218-479 |
| P11172 | DB03685 | U5P | 2v30 | e2v30B1 | B:223-478 |
| P11172 | DB03685 | U5P | 3bgj | e3bgjA1 | A:34-290 |
| P11172 | DB03685 | U5P | 3bgj | e3bgjB1 | B:34-290 |
| P11172 | DB03685 | U5P | 3ewy | e3ewyA1 | A:223-479 |
| P11172 | DB03685 | U5P | 3ex1 | e3ex1A1 | A:223-479 |
| P11172 | DB03685 | U5P | 3ex1 | e3ex1B1 | B:223-479 |
| P11172 | DB03685 | U5P | 3ex3 | e3ex3A1 | A:223-479 |
| P11172 | DB03685 | U5P | 3ex3 | e3ex3B1 | B:223-479 |
| P11172 | DB03685 | U5P | 3ex6 | e3ex6A1 | A:223-479 |
| P11172 | DB03685 | U5P | 3ex6 | e3ex6B1 | B:223-479 |
| P11172 | DB03685 | U5P | 6ywu | e6ywuA1 | A:224-479 |
| P11172 | DB03685 | U5P | 6zwy | e6zwyA1 | A:223-479 |
| P11172 | DB03685 | U5P | 7asq | e7asqA1 | A:223-478 |