Attributes
UniProt ID
Protein Name
Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Ligand Name
THIAMINE DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AYEKOFBPNLCAJY-UHFFFAOYSA-O
SMILES
Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NI4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ni4A1e1ni4B1e1ni4B2e1ni4C1e1ni4D1e1ni4D2
ECOD domains from experimental PDB structures interacting with ligand TPP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11177 | n/a | TPP | 1ni4 | e1ni4B2 | B:0-191 |
| P11177 | n/a | TPP | 1ni4 | e1ni4D2 | D:0-191 |
| P11177 | n/a | TPP | 2ozl | e2ozlB2 | B:0-191 |
| P11177 | n/a | TPP | 2ozl | e2ozlD2 | D:0-191 |
| P11177 | n/a | TPP | 3exe | e3exeB2 | B:1-191 |
| P11177 | n/a | TPP | 3exe | e3exeD2 | D:1-191 |
| P11177 | n/a | TPP | 3exe | e3exeF2 | F:1-191 |
| P11177 | n/a | TPP | 3exe | e3exeH2 | H:1-191 |
| P11177 | n/a | TPP | 3exf | e3exfB2 | B:1-191 |
| P11177 | n/a | TPP | 3exf | e3exfD2 | D:1-191 |
| P11177 | n/a | TPP | 3exf | e3exfF2 | F:1-191 |
| P11177 | n/a | TPP | 3exf | e3exfH2 | H:1-191 |
| P11177 | n/a | TPP | 3exh | e3exhB2 | B:1-191 |
| P11177 | n/a | TPP | 3exh | e3exhD2 | D:1-191 |
| P11177 | n/a | TPP | 3exh | e3exhF2 | F:1-191 |
| P11177 | n/a | TPP | 3exh | e3exhH2 | H:1-191 |
| P11177 | n/a | TPP | 6cer | e6cerB2 | B:0-191 |
| P11177 | n/a | TPP | 6cer | e6cerD1 | D:-1-191 |
| P11177 | n/a | TPP | 6cer | e6cerF1 | F:0-191 |
| P11177 | n/a | TPP | 6cer | e6cerH2 | H:-1-191 |