Attributes
UniProt ID
Protein Name
Glucose-6-phosphate 1-dehydrogenase
Ligand Name
6-O-phosphono-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NBSCHQHZLSJFNQ-VFUOTHLCSA-N
SMILES
C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BHL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2bhlA1e2bhlA2e2bhlB1e2bhlB2
ECOD domains from experimental PDB structures interacting with ligand DB04122
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11413 | DB04122 | BG6 | 2bhl | e2bhlA1 | A:27-204,A:435-448 |
| P11413 | DB04122 | BG6 | 2bhl | e2bhlA2 | A:205-505 |
| P11413 | DB04122 | BG6 | 2bhl | e2bhlB1 | B:27-204,B:435-448 |
| P11413 | DB04122 | BG6 | 2bhl | e2bhlB2 | B:205-505 |
| P11413 | DB04122 | BG6 | 5ukw | e5ukwA1 | A:28-204,A:435-448 |
| P11413 | DB04122 | BG6 | 5ukw | e5ukwA2 | A:205-504 |
| P11413 | DB04122 | BG6 | 7sni | e7sniA1 | A:205-515 |
| P11413 | DB04122 | BG6 | 7sni | e7sniA2 | A:28-204,A:435-448 |
| P11413 | DB04122 | BG6 | 7sni | e7sniB1 | B:28-204,B:435-448 |
| P11413 | DB04122 | BG6 | 7sni | e7sniB2 | B:205-515 |
| P11413 | DB04122 | BG6 | 7sni | e7sniC1 | C:205-515 |
| P11413 | DB04122 | BG6 | 7sni | e7sniC2 | C:28-204,C:435-448 |
| P11413 | DB04122 | BG6 | 7sni | e7sniD1 | D:28-204,D:435-448 |
| P11413 | DB04122 | BG6 | 7sni | e7sniD2 | D:205-515 |
| P11413 | DB04122 | BG6 | 7ual | e7ualA1 | A:28-204,A:435-448 |
| P11413 | DB04122 | BG6 | 7ual | e7ualA2 | A:205-511 |
| P11413 | DB04122 | BG6 | 7ual | e7ualB1 | B:205-511 |
| P11413 | DB04122 | BG6 | 7ual | e7ualB2 | B:28-204,B:435-448 |
| P11413 | DB04122 | BG6 | 7ual | e7ualC1 | C:205-511 |
| P11413 | DB04122 | BG6 | 7ual | e7ualC2 | C:28-204,C:435-448 |
| P11413 | DB04122 | BG6 | 7ual | e7ualD1 | D:205-511 |
| P11413 | DB04122 | BG6 | 7ual | e7ualD2 | D:28-204,D:435-448 |