Attributes
UniProt ID
Protein Name
Methyl-coenzyme M reductase I subunit beta
Ligand Name
Coenzyme B
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JBJSVEVEEGOEBZ-SCZZXKLOSA-N
SMILES
CC(C(C(=O)O)NC(=O)CCCCCCS)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1HBN
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1hbnA1e1hbnA2e1hbnB1e1hbnB2e1hbnC1e1hbnD1e1hbnD2e1hbnE1e1hbnE2e1hbnF1
ECOD domains from experimental PDB structures interacting with ligand TP7
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11560 | n/a | TP7 | 1hbn | e1hbnB1 | B:189-443 |
| P11560 | n/a | TP7 | 1hbn | e1hbnE1 | E:189-443 |
| P11560 | n/a | TP7 | 1hbo | e1hboB1 | B:189-443 |
| P11560 | n/a | TP7 | 1hbo | e1hboE1 | E:189-443 |
| P11560 | n/a | TP7 | 1hbu | e1hbuB1 | B:189-443 |
| P11560 | n/a | TP7 | 1hbu | e1hbuE1 | E:189-443 |
| P11560 | n/a | TP7 | 1mro | e1mroE1 | E:189-443 |
| P11560 | n/a | TP7 | 3m1v | e3m1vB1 | B:189-443 |
| P11560 | n/a | TP7 | 3m1v | e3m1vE1 | E:189-443 |
| P11560 | n/a | TP7 | 3m2r | e3m2rB1 | B:189-443 |
| P11560 | n/a | TP7 | 3m2r | e3m2rE1 | E:189-443 |
| P11560 | n/a | TP7 | 3m2u | e3m2uB1 | B:189-443 |
| P11560 | n/a | TP7 | 3m2u | e3m2uE1 | E:189-443 |
| P11560 | n/a | TP7 | 3m2v | e3m2vB1 | B:189-443 |
| P11560 | n/a | TP7 | 3m2v | e3m2vE1 | E:189-443 |
| P11560 | n/a | TP7 | 3m30 | e3m30B1 | B:189-443 |
| P11560 | n/a | TP7 | 3m30 | e3m30E1 | E:189-443 |
| P11560 | n/a | TP7 | 3m32 | e3m32B1 | B:189-443 |
| P11560 | n/a | TP7 | 3m32 | e3m32E1 | E:189-443 |
| P11560 | n/a | TP7 | 3pot | e3potB1 | B:189-443 |
| P11560 | n/a | TP7 | 3pot | e3potE1 | E:189-443 |
| P11560 | n/a | TP7 | 5a0y | e5a0yB1 | B:189-443 |
| P11560 | n/a | TP7 | 5a0y | e5a0yE2 | E:189-443 |
| P11560 | n/a | TP7 | 5g0r | e5g0rB1 | B:189-443 |
| P11560 | n/a | TP7 | 5g0r | e5g0rE1 | E:189-443 |
| P11560 | n/a | TP7 | 7b2h | e7b2hB1 | B:189-443 |
| P11560 | n/a | TP7 | 7b2h | e7b2hE1 | E:189-443 |
| P11560 | n/a | TP7 | 7suc | e7sucb2 | b:189-443 |
| P11560 | n/a | TP7 | 7sxm | e7sxmE1 | E:189-443 |