Attributes
UniProt ID
Protein Name
Ornithine decarboxylase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2OO0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2oo0A3e2oo0A4e2oo0B3e2oo0B4
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P11926 | DB00114 | PLP | 2oo0 | e2oo0A3 | A:-9-43,A:282-422 |
| P11926 | DB00114 | PLP | 2oo0 | e2oo0A4 | A:44-284 |
| P11926 | DB00114 | PLP | 2oo0 | e2oo0B3 | B:-8-43,B:282-422 |
| P11926 | DB00114 | PLP | 2oo0 | e2oo0B4 | B:44-284 |
| P11926 | DB00114 | PLP | 4zgy | e4zgyA1 | A:44-284 |
| P11926 | DB00114 | PLP | 4zgy | e4zgyA2 | A:19-43,A:282-421 |
| P11926 | DB00114 | PLP | 5bwa | e5bwaA1 | A:44-284 |
| P11926 | DB00114 | PLP | 5bwa | e5bwaA2 | A:19-43,A:282-410 |
| P11926 | DB00114 | PLP | 7s3f | e7s3fA1 | A:44-283 |
| P11926 | DB00114 | PLP | 7s3f | e7s3fA2 | A:1-43,A:271-422 |
| P11926 | DB00114 | PLP | 7s3f | e7s3fB1 | B:44-283 |
| P11926 | DB00114 | PLP | 7s3f | e7s3fB2 | B:7-43,B:271-422 |
| P11926 | DB00114 | PLP | 7s3g | e7s3gA1 | A:44-283 |
| P11926 | DB00114 | PLP | 7s3g | e7s3gA2 | A:6-43,A:271-422 |
| P11926 | DB00114 | PLP | 7s3g | e7s3gB1 | B:44-283 |
| P11926 | DB00114 | PLP | 7s3g | e7s3gB2 | B:1-43,B:271-422 |
| P11926 | DB00114 | PLP | 7u6u | e7u6uA1 | A:44-284 |
| P11926 | DB00114 | PLP | 7u6u | e7u6uA2 | A:7-43,A:282-422 |
| P11926 | DB00114 | PLP | 7u6u | e7u6uB1 | B:44-284 |
| P11926 | DB00114 | PLP | 7u6u | e7u6uB2 | B:1-43,B:282-422 |