Attributes
UniProt ID
Protein Name
Photosystem I reaction center subunit III, chloroplastic
Ligand Name
CHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES
CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6IJJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ijj11e6ijj31e6ijj41e6ijj51e6ijj61e6ijj71e6ijj81e6ijjA1e6ijjA2e6ijjB1e6ijjB2e6ijjC1e6ijjD1e6ijjE1e6ijjF1e6ijjI1e6ijjJ1e6ijjK1e6ijjL1e6ijja1
ECOD domains from experimental PDB structures interacting with ligand DB02133
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P12356 | DB02133 | CLA | 6ijj | e6ijjF1 | F:63-226 |
| P12356 | DB02133 | CLA | 6ijo | e6ijoF1 | F:63-226 |
| P12356 | DB02133 | CLA | 6jo5 | e6jo5F1 | F:63-227 |
| P12356 | DB02133 | CLA | 6jo6 | e6jo6F1 | F:63-227 |
| P12356 | DB02133 | CLA | 7bgi | e7bgiF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7blx | e7blxF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7d0j | e7d0jF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7dz7 | e7dz7F1 | F:63-227 |
| P12356 | DB02133 | CLA | 7dz8 | e7dz8F1 | F:63-227 |
| P12356 | DB02133 | CLA | 7r3k | e7r3kF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7wyi | e7wyiF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7wzn | e7wznF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7zq9 | e7zq9F1 | F:63-227 |
| P12356 | DB02133 | CLA | 7zqc | e7zqcF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7zqd | e7zqdF1 | F:63-227 |
| P12356 | DB02133 | CLA | 7zqd | e7zqdF21 | F2:63-227 |
| P12356 | DB02133 | CLA | 8h2u | e8h2uF1 | F:63-217 |