Attributes
UniProt ID
Protein Name
DNA repair protein REV1
Ligand Name
2'-DEOXYCYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGWHQCVHVJXOKC-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2AQ4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2aq4A13e2aq4A14e2aq4A15e2aq4A16
ECOD domains from experimental PDB structures interacting with ligand DB03258
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P12689 | DB03258 | DCP | 2aq4 | e2aq4A13 | A:377-437 |
| P12689 | DB03258 | DCP | 2aq4 | e2aq4A14 | A:305-376,A:438-546 |
| P12689 | DB03258 | DCP | 3bjy | e3bjyA13 | A:377-436 |
| P12689 | DB03258 | DCP | 3bjy | e3bjyA14 | A:305-376,A:437-544 |
| P12689 | DB03258 | DCP | 3osp | e3ospA10 | A:305-376,A:438-546 |
| P12689 | DB03258 | DCP | 3osp | e3ospA9 | A:377-437 |
| P12689 | DB03258 | DCP | 5wm1 | e5wm1A3 | A:377-437 |
| P12689 | DB03258 | DCP | 5wm1 | e5wm1A4 | A:306-376,A:438-546 |
| P12689 | DB03258 | DCP | 5wm8 | e5wm8A2 | A:377-437 |
| P12689 | DB03258 | DCP | 5wm8 | e5wm8A3 | A:307-376,A:438-546 |
| P12689 | DB03258 | DCP | 5wmb | e5wmbA1 | A:377-437 |
| P12689 | DB03258 | DCP | 5wmb | e5wmbA4 | A:306-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x6z | e6x6zA1 | A:377-437 |
| P12689 | DB03258 | DCP | 6x6z | e6x6zA4 | A:307-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x71 | e6x71A1 | A:307-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x71 | e6x71A3 | A:377-437 |
| P12689 | DB03258 | DCP | 6x75 | e6x75A2 | A:377-437 |
| P12689 | DB03258 | DCP | 6x75 | e6x75A3 | A:307-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x76 | e6x76A1 | A:377-437 |
| P12689 | DB03258 | DCP | 6x76 | e6x76A2 | A:307-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x77 | e6x77A1 | A:308-376,A:438-546 |
| P12689 | DB03258 | DCP | 6x77 | e6x77A3 | A:377-437 |