Attributes
UniProt ID
Protein Name
Aerobic glycerol-3-phosphate dehydrogenase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QCU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qcuA10e2qcuA11e2qcuA12e2qcuB1e2qcuB2e2qcuB3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13035 | DB03147 | FAD | 2qcu | e2qcuA10 | A:226-321 |
| P13035 | DB03147 | FAD | 2qcu | e2qcuA11 | A:3-225,A:322-387 |
| P13035 | DB03147 | FAD | 2qcu | e2qcuB1 | B:226-321 |
| P13035 | DB03147 | FAD | 2qcu | e2qcuB3 | B:1-225,B:322-387 |
| P13035 | DB03147 | FAD | 2r45 | e2r45A10 | A:226-321 |
| P13035 | DB03147 | FAD | 2r45 | e2r45A11 | A:1-225,A:322-387 |
| P13035 | DB03147 | FAD | 2r45 | e2r45B10 | B:226-321 |
| P13035 | DB03147 | FAD | 2r45 | e2r45B11 | B:1-225,B:322-387 |
| P13035 | DB03147 | FAD | 2r46 | e2r46A10 | A:226-321 |
| P13035 | DB03147 | FAD | 2r46 | e2r46A11 | A:1-225,A:322-387 |
| P13035 | DB03147 | FAD | 2r46 | e2r46B7 | B:226-321 |
| P13035 | DB03147 | FAD | 2r46 | e2r46B8 | B:1-225,B:322-387 |
| P13035 | DB03147 | FAD | 2r4e | e2r4eA10 | A:226-321 |
| P13035 | DB03147 | FAD | 2r4e | e2r4eA11 | A:1-225,A:322-387 |
| P13035 | DB03147 | FAD | 2r4e | e2r4eB10 | B:226-321 |
| P13035 | DB03147 | FAD | 2r4e | e2r4eB11 | B:1-225,B:322-387 |
| P13035 | DB03147 | FAD | 2r4j | e2r4jA10 | A:226-321 |
| P13035 | DB03147 | FAD | 2r4j | e2r4jA11 | A:1-225,A:322-387 |
| P13035 | DB03147 | FAD | 2r4j | e2r4jB10 | B:226-321 |
| P13035 | DB03147 | FAD | 2r4j | e2r4jB11 | B:1-225,B:322-387 |