Attributes
UniProt ID
Protein Name
Bleomycin resistance protein
Ligand Name
BLEOMYCIN A2
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZGCQRJQBETWECF-UAPAGMARSA-N
SMILES
Cc1c(nc(nc1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(c2c[nH]cn2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCc5nc(cs5)c6nc(cs6)C(=O)NCCCS(C)C)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1EWJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ewjA1e1ewjA2e1ewjB1e1ewjB2e1ewjC1e1ewjC2e1ewjD1e1ewjD2e1ewjE1e1ewjE2e1ewjF1e1ewjF2e1ewjG1e1ewjG2e1ewjH1e1ewjH2
ECOD domains from experimental PDB structures interacting with ligand DB00290
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13081 | DB00290 | BLM | 1ewj | e1ewjA1 | A:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjA2 | A:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjB1 | B:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjB2 | B:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjC1 | C:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjC2 | C:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjD1 | D:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjD2 | D:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjE1 | E:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjE2 | E:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjF1 | F:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjF2 | F:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjG1 | G:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjG2 | G:53-120 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjH1 | H:2-52 |
| P13081 | DB00290 | BLM | 1ewj | e1ewjH2 | H:53-120 |
| P13081 | DB00290 | BLM | 1niq | e1niqB1 | B:2-52 |
| P13081 | DB00290 | BLM | 1niq | e1niqC2 | C:53-120 |