Attributes
UniProt ID
Protein Name
Cytochrome c oxidase subunit 7B, mitochondrial
Ligand Name
DECYL-BETA-D-MALTOPYRANOSIDE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WOQQAWHSKSSAGF-WXFJLFHKSA-N
SMILES
CCCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5B1B
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5b1bA1e5b1bB1e5b1bB2e5b1bC1e5b1bD1e5b1bE1e5b1bF1e5b1bG1e5b1bH1e5b1bI1e5b1bJ1e5b1bK1e5b1bL1e5b1bM1e5b1bN1e5b1bO1e5b1bO2e5b1bP1e5b1bQ1e5b1bR1e5b1bS1e5b1bT1e5b1bU1e5b1bV1e5b1bW1e5b1bX1e5b1bY1e5b1bZ1
ECOD domains from experimental PDB structures interacting with ligand DMU
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13183 | n/a | DMU | 5b1b | e5b1bK1 | K:6-54 |
| P13183 | n/a | DMU | 5b1b | e5b1bX1 | X:6-54 |
| P13183 | n/a | DMU | 5b3s | e5b3sK1 | K:6-54 |
| P13183 | n/a | DMU | 5b3s | e5b3sX1 | X:6-54 |
| P13183 | n/a | DMU | 6juw | e6juwK1 | K:6-54 |
| P13183 | n/a | DMU | 6juw | e6juwX1 | X:6-54 |
| P13183 | n/a | DMU | 7coh | e7cohK1 | K:6-54 |
| P13183 | n/a | DMU | 7coh | e7cohX1 | X:6-54 |
| P13183 | n/a | DMU | 7cp5 | e7cp5K1 | K:6-54 |
| P13183 | n/a | DMU | 7cp5 | e7cp5X1 | X:6-54 |
| P13183 | n/a | DMU | 7d5w | e7d5wK1 | K:6-54 |
| P13183 | n/a | DMU | 7d5w | e7d5wX1 | X:6-54 |
| P13183 | n/a | DMU | 7d5x | e7d5xK1 | K:6-54 |
| P13183 | n/a | DMU | 7d5x | e7d5xX1 | X:6-54 |
| P13183 | n/a | DMU | 7vuw | e7vuwX1 | X:6-54 |
| P13183 | n/a | DMU | 7w3e | e7w3eK1 | K:6-54 |
| P13183 | n/a | DMU | 7w3e | e7w3eX1 | X:6-54 |
| P13183 | n/a | DMU | 7y44 | e7y44K1 | K:6-54 |
| P13183 | n/a | DMU | 7y44 | e7y44X1 | X:6-54 |
| P13183 | n/a | DMU | 7ypy | e7ypyK1 | K:6-54 |
| P13183 | n/a | DMU | 8h8r | e8h8rK1 | K:6-54 |
| P13183 | n/a | DMU | 8h8r | e8h8rX1 | X:6-54 |
| P13183 | n/a | DMU | 8h8s | e8h8sK1 | K:6-54 |
| P13183 | n/a | DMU | 8h8s | e8h8sX1 | X:6-54 |