Attributes
UniProt ID
Protein Name
L-methionine gamma-lyase
Ligand Name
(2E)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)amino]-4-(methylsulfanyl)but-2-enoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
LPFNPHQQDYAHKU-QDEBKDIKSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CNC(=CCSC)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5X2W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5x2wA1e5x2wA2e5x2wB1e5x2wB2e5x2wC1e5x2wC2e5x2wD1e5x2wD2
ECOD domains from experimental PDB structures interacting with ligand 3LM
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13254 | n/a | 3LM | 5x2w | e5x2wA1 | A:7-262 |
| P13254 | n/a | 3LM | 5x2w | e5x2wA2 | A:263-398 |
| P13254 | n/a | 3LM | 5x2w | e5x2wB1 | B:7-262 |
| P13254 | n/a | 3LM | 5x2w | e5x2wB2 | B:263-398 |
| P13254 | n/a | 3LM | 5x2w | e5x2wC1 | C:263-398 |
| P13254 | n/a | 3LM | 5x2w | e5x2wC2 | C:7-262 |
| P13254 | n/a | 3LM | 5x2w | e5x2wD1 | D:263-398 |
| P13254 | n/a | 3LM | 5x2w | e5x2wD2 | D:1-262 |
| P13254 | n/a | 3LM | 5x2z | e5x2zA1 | A:263-398 |
| P13254 | n/a | 3LM | 5x2z | e5x2zA2 | A:7-262 |
| P13254 | n/a | 3LM | 5x2z | e5x2zB1 | B:7-262 |
| P13254 | n/a | 3LM | 5x2z | e5x2zB2 | B:263-398 |
| P13254 | n/a | 3LM | 5x2z | e5x2zC1 | C:7-262 |
| P13254 | n/a | 3LM | 5x2z | e5x2zC2 | C:263-398 |
| P13254 | n/a | 3LM | 5x2z | e5x2zD1 | D:263-398 |
| P13254 | n/a | 3LM | 5x2z | e5x2zD2 | D:3-262 |
| P13254 | n/a | 3LM | 7f1u | e7f1uA1 | A:3-262 |
| P13254 | n/a | 3LM | 7f1u | e7f1uA2 | A:263-398 |
| P13254 | n/a | 3LM | 7f1u | e7f1uB2 | B:7-262 |
| P13254 | n/a | 3LM | 7f1u | e7f1uC1 | C:7-262 |
| P13254 | n/a | 3LM | 7f1u | e7f1uC2 | C:263-398 |
| P13254 | n/a | 3LM | 7f1u | e7f1uD1 | D:263-398 |
| P13254 | n/a | 3LM | 7f1u | e7f1uD2 | D:7-262 |