Attributes
UniProt ID
Protein Name
Cytochrome b-c1 complex subunit 8
Ligand Name
1,2-dioleoyl-sn-glycero-3-phosphoethanolamine
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MWRBNPKJOOWZPW-NYVOMTAGSA-N
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1BCC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1bccA1e1bccA2e1bccB1e1bccB2e1bccC1e1bccC2e1bccD1e1bccD2e1bccE2e1bccE3e1bccF1e1bccG1e1bccH1e1bccJ1
ECOD domains from experimental PDB structures interacting with ligand DB04327
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13271 | DB04327 | PEE | 1bcc | e1bccG1 | G:2-75 |
| P13271 | DB04327 | PEE | 1pp9 | e1pp9G1 | G:1-75 |
| P13271 | DB04327 | PEE | 1pp9 | e1pp9T1 | T:1-75 |
| P13271 | DB04327 | PEE | 1ppj | e1ppjG1 | G:1-75 |
| P13271 | DB04327 | PEE | 1ppj | e1ppjT1 | T:1-75 |
| P13271 | DB04327 | PEE | 1sqp | e1sqpG1 | G:1-75 |
| P13271 | DB04327 | PEE | 2a06 | e2a06G1 | G:1-75 |
| P13271 | DB04327 | PEE | 2a06 | e2a06T1 | T:1-75 |
| P13271 | DB04327 | PEE | 4d6t | e4d6tG1 | G:2-81 |
| P13271 | DB04327 | PEE | 4d6t | e4d6tT1 | T:2-75 |
| P13271 | DB04327 | PEE | 4d6u | e4d6uG1 | G:2-81 |
| P13271 | DB04327 | PEE | 4d6u | e4d6uT1 | T:2-75 |
| P13271 | DB04327 | PEE | 5nmi | e5nmiG1 | G:1-74 |
| P13271 | DB04327 | PEE | 5nmi | e5nmiT1 | T:2-81 |
| P13271 | DB04327 | PEE | 5okd | e5okdG1 | G:2-75 |
| P13271 | DB04327 | PEE | 6haw | e6hawG1 | G:2-75 |
| P13271 | DB04327 | PEE | 6xvf | e6xvfG1 | G:2-75 |
| P13271 | DB04327 | PEE | 6zfs | e6zfsG1 | G:1-75 |
| P13271 | DB04327 | PEE | 6zft | e6zftG1 | G:2-75 |
| P13271 | DB04327 | PEE | 6zfu | e6zfuG1 | G:2-75 |
| P13271 | DB04327 | PEE | 7r3v | e7r3vG1 | G:2-75 |