Attributes
UniProt ID
Protein Name
Glycogen synthase, muscle
Ligand Name
6-O-phosphono-alpha-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NBSCHQHZLSJFNQ-DVKNGEFBSA-N
SMILES
C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7Q0S
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7q0sA1e7q0sA2e7q0sB1e7q0sB2e7q0sC1e7q0sC2e7q0sD1e7q0sD2
ECOD domains from experimental PDB structures interacting with ligand DB02007
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13807 | DB02007 | G6P | 7q0s | e7q0sA2 | A:283-642 |
| P13807 | DB02007 | G6P | 7q0s | e7q0sB1 | B:283-642 |
| P13807 | DB02007 | G6P | 7q0s | e7q0sC2 | C:283-642 |
| P13807 | DB02007 | G6P | 7q0s | e7q0sD2 | D:283-642 |
| P13807 | DB02007 | G6P | 7q12 | e7q12A1 | A:283-618 |
| P13807 | DB02007 | G6P | 7q12 | e7q12B2 | B:283-618 |
| P13807 | DB02007 | G6P | 7q12 | e7q12C2 | C:283-618 |
| P13807 | DB02007 | G6P | 7q12 | e7q12D2 | D:283-618 |
| P13807 | DB02007 | G6P | 7q13 | e7q13A2 | A:283-618 |
| P13807 | DB02007 | G6P | 7q13 | e7q13B1 | B:283-618 |
| P13807 | DB02007 | G6P | 7q13 | e7q13C1 | C:283-618 |
| P13807 | DB02007 | G6P | 7q13 | e7q13D2 | D:283-618 |
| P13807 | DB02007 | G6P | 8cvx | e8cvxA2 | A:283-625 |
| P13807 | DB02007 | G6P | 8cvx | e8cvxB2 | B:283-625 |
| P13807 | DB02007 | G6P | 8cvx | e8cvxC1 | C:283-625 |
| P13807 | DB02007 | G6P | 8cvx | e8cvxD1 | D:283-625 |