Attributes
UniProt ID
Protein Name
Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Ligand Name
(2S)-2-[[4-[(4-azanyl-6-oxidanyl-pyrimidin-5-yl)carbamoylamino]phenyl]carbonylamino]pentanedioic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OUMOQELZARCDHX-JTQLQIEISA-N
SMILES
c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)NC(=O)Nc2c(ncnc2O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7EHJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ehjA1e7ehjA2e7ehjB1e7ehjB2
ECOD domains from experimental PDB structures interacting with ligand J49
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P13995 | n/a | J49 | 7ehj | e7ehjA1 | A:36-181 |
| P13995 | n/a | J49 | 7ehj | e7ehjA2 | A:174-332 |
| P13995 | n/a | J49 | 7ehj | e7ehjB1 | B:36-181 |
| P13995 | n/a | J49 | 7ehj | e7ehjB2 | B:174-332 |
| P13995 | n/a | J49 | 7ehm | e7ehmA1 | A:36-181 |
| P13995 | n/a | J49 | 7ehm | e7ehmA2 | A:174-330 |
| P13995 | n/a | J49 | 7ehm | e7ehmB1 | B:36-181 |
| P13995 | n/a | J49 | 7ehm | e7ehmB2 | B:174-330 |
| P13995 | n/a | J49 | 7ehn | e7ehnA1 | A:36-181 |
| P13995 | n/a | J49 | 7ehn | e7ehnA2 | A:174-330 |
| P13995 | n/a | J49 | 7ehn | e7ehnB1 | B:36-181 |
| P13995 | n/a | J49 | 7ehn | e7ehnB2 | B:174-330 |
| P13995 | n/a | J49 | 7ehv | e7ehvA1 | A:36-181 |
| P13995 | n/a | J49 | 7ehv | e7ehvA2 | A:174-330 |
| P13995 | n/a | J49 | 7ehv | e7ehvB1 | B:36-181 |
| P13995 | n/a | J49 | 7ehv | e7ehvB2 | B:174-330 |