Attributes
UniProt ID
Protein Name
Hepatocyte growth factor
Ligand Name
4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JKMHFZQWWAIEOD-UHFFFAOYSA-N
SMILES
C1CN(CCN1CCO)CCS(=O)(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1BHT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1bhtA1e1bhtA2e1bhtB1e1bhtB2
ECOD domains from experimental PDB structures interacting with ligand DB16872
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P14210 | DB16872 | EPE | 1bht | e1bhtA1 | A:127-210 |
| P14210 | DB16872 | EPE | 1bht | e1bhtB1 | B:427-509 |
| P14210 | DB16872 | EPE | 1gmn | e1gmnA1 | A:127-207 |
| P14210 | DB16872 | EPE | 1gmn | e1gmnB1 | B:127-209 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoA1 | A:127-208 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoB1 | B:127-208 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoC1 | C:127-208 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoC2 | C:37-125 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoD1 | D:127-208 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoE1 | E:127-209 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoF1 | F:127-209 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoG1 | G:127-208 |
| P14210 | DB16872 | EPE | 1gmo | e1gmoH1 | H:127-208 |
| P14210 | DB16872 | EPE | 1gp9 | e1gp9A1 | A:127-208 |
| P14210 | DB16872 | EPE | 1gp9 | e1gp9B1 | B:127-208 |
| P14210 | DB16872 | EPE | 1gp9 | e1gp9B2 | B:39-125 |
| P14210 | DB16872 | EPE | 1gp9 | e1gp9C1 | C:127-208 |
| P14210 | DB16872 | EPE | 1gp9 | e1gp9D1 | D:127-208 |
| P14210 | DB16872 | EPE | 3hn4 | e3hn4A2 | A:127-210 |
| P14210 | DB16872 | EPE | 3mkp | e3mkpA1 | A:127-208 |
| P14210 | DB16872 | EPE | 3mkp | e3mkpB1 | B:127-208 |
| P14210 | DB16872 | EPE | 3mkp | e3mkpC1 | C:127-208 |
| P14210 | DB16872 | EPE | 3mkp | e3mkpD1 | D:127-208 |
| P14210 | DB16872 | EPE | 5coe | e5coeB2 | B:127-209 |
| P14210 | DB16872 | EPE | 7ocm | e7ocmA1 | A:4-86 |