Attributes
UniProt ID
Protein Name
Interleukin-2 receptor subunit beta
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2B5I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2b5iA1e2b5iB1e2b5iB2e2b5iC1e2b5iC2e2b5iD1e2b5iD2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P14784 | DB00141 | NAG | 2b5i | e2b5iB2 | B:104-207 |
| P14784 | DB00141 | NAG | 2erj | e2erjB3 | B:98-209 |
| P14784 | DB00141 | NAG | 2erj | e2erjB4 | B:6-97 |
| P14784 | DB00141 | NAG | 2erj | e2erjF3 | F:98-209 |
| P14784 | DB00141 | NAG | 2erj | e2erjF4 | F:6-97 |
| P14784 | DB00141 | NAG | 3qaz | e3qazB3 | B:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazE7 | E:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazH3 | H:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazK3 | K:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazN3 | N:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazQ3 | Q:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazT3 | T:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazW3 | W:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazZ3 | Z:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazc3 | c:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazf3 | f:98-207 |
| P14784 | DB00141 | NAG | 3qaz | e3qazi3 | i:98-207 |
| P14784 | DB00141 | NAG | 4gs7 | e4gs7B2 | B:98-207 |
| P14784 | DB00141 | NAG | 5m5e | e5m5eB1 | B:6-97 |
| P14784 | DB00141 | NAG | 5m5e | e5m5eB2 | B:98-208 |