Attributes
UniProt ID
Protein Name
Gamma-aminobutyric acid receptor subunit alpha-1 receptor subunit alpha-1
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6D6T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6d6tA1e6d6tA2e6d6tB1e6d6tB2e6d6tC1e6d6tC2e6d6tD1e6d6tD2e6d6tE1e6d6tI1e6d6tJ1e6d6tK1e6d6tL1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P14867 | DB00141 | NAG | 6d6t | e6d6tD2 | D:11-222 |
| P14867 | DB00141 | NAG | 6d6u | e6d6uD2 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3s | e6x3sD1 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3t | e6x3tD1 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3u | e6x3uD2 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3v | e6x3vD1 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3w | e6x3wD2 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3x | e6x3xD1 | D:10-222 |
| P14867 | DB00141 | NAG | 6x3z | e6x3zD2 | D:10-222 |
| P14867 | DB00141 | NAG | 6x40 | e6x40D2 | D:10-222 |
| P14867 | DB00141 | NAG | 7pbd | e7pbdA2 | A:12-590 |
| P14867 | DB00141 | NAG | 7pbd | e7pbdD2 | D:12-222 |
| P14867 | DB00141 | NAG | 7pbz | e7pbzA1 | A:12-222 |
| P14867 | DB00141 | NAG | 7pbz | e7pbzD2 | D:12-222 |
| P14867 | DB00141 | NAG | 7pc0 | e7pc0A1 | A:12-222 |
| P14867 | DB00141 | NAG | 7pc0 | e7pc0D2 | D:12-222 |
| P14867 | DB00141 | NAG | 7t0z | e7t0zD2 | D:10-222 |
| P14867 | DB00141 | NAG | 8dd3 | e8dd3D2 | D:10-222 |
| P14867 | DB00141 | NAG | 8sgo | e8sgoD1 | D:10-222 |
| P14867 | DB00141 | NAG | 8si9 | e8si9D2 | D:11-222 |
| P14867 | DB00141 | NAG | 8sid | e8sidD2 | D:10-222 |